C8H14N2O2S2 — CID 63732116
N-(2-aminopropyl)-5-methylthiophene-2-sulfonamide (PubChem CID 63732116) has the molecular formula C8H14N2O2S2 and a molecular weight of 234.35 g/mol. Its IUPAC name is N-(2-aminopropyl)-5-methylthiophene-2-sulfonamide.
| Compound Name | N-(2-aminopropyl)-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 63732116 |
| Molecular Formula | C8H14N2O2S2 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | N-(2-aminopropyl)-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(C)N)s1 |
| InChI | InChI=1S/C8H14N2O2S2/c1-6(9)5-10-14(11,12)8-4-3-7(2)13-8/h3-4,6,10H,5,9H2,1-2H3 |
| InChIKey | ZFNGOARVROJUHS-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |