C11H13NO3S3 — CID 90500280
N-(2-hydroxy-2-thiophen-2-ylethyl)-5-methylthiophene-2-sulfonamide (PubChem CID 90500280) has the molecular formula C11H13NO3S3 and a molecular weight of 303.43 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-2-ylethyl)-5-methylthiophene-2-sulfonamide.
| Compound Name | N-(2-hydroxy-2-thiophen-2-ylethyl)-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 90500280 |
| Molecular Formula | C11H13NO3S3 |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-2-ylethyl)-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(O)c2cccs2)s1 |
| InChI | InChI=1S/C11H13NO3S3/c1-8-4-5-11(17-8)18(14,15)12-7-9(13)10-3-2-6-16-10/h2-6,9,12-13H,7H2,1H3 |
| InChIKey | OENKZUZGOAIOSC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |