C9H14BrNO3S2 — CID 90598463
1-bromo-N-[2-methoxy-2-(5-methylthiophen-2-yl)ethyl]methanesulfonamide (PubChem CID 90598463) has the molecular formula C9H14BrNO3S2 and a molecular weight of 328.25 g/mol. Its IUPAC name is 1-bromo-N-[2-methoxy-2-(5-methylthiophen-2-yl)ethyl]methanesulfonamide.
| Compound Name | 1-bromo-N-[2-methoxy-2-(5-methylthiophen-2-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 90598463 |
| Molecular Formula | C9H14BrNO3S2 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 326.96 |
| IUPAC Name | 1-bromo-N-[2-methoxy-2-(5-methylthiophen-2-yl)ethyl]methanesulfonamide |
| SMILES | COC(CNS(=O)(=O)CBr)c1ccc(C)s1 |
| InChI | InChI=1S/C9H14BrNO3S2/c1-7-3-4-9(15-7)8(14-2)5-11-16(12,13)6-10/h3-4,8,11H,5-6H2,1-2H3 |
| InChIKey | HXBPRLSTPGMVHU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|