C19H24N2O5S — CID 92683906
N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]-2-methyl-5-nitrobenzenesulfonamide (PubChem CID 92683906) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]-2-methyl-5-nitrobenzenesulfonamide.
| Compound Name | N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]-2-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 92683906 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]-2-methyl-5-nitrobenzenesulfonamide |
| SMILES | COc1ccc([C@@H](CC(C)C)NS(=O)(=O)c2cc([N+](=O)[O-])ccc2C)cc1 |
| InChI | InChI=1S/C19H24N2O5S/c1-13(2)11-18(15-6-9-17(26-4)10-7-15)20-27(24,25)19-12-16(21(22)23)8-5-14(19)3/h5-10,12-13,18,20H,11H2,1-4H3/t18-/m1/s1 |
| InChIKey | UOEYNKAXIZGFGB-GOSISDBHSA-N |
| XLogP | 3.98 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|