C22H28N2O3S — CID 100962662
N-[(1R,3S)-1-isocyano-1-(4-methoxyphenyl)-5-methylhexan-3-yl]-4-methylbenzenesulfonamide (PubChem CID 100962662) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is N-[(1R,3S)-1-isocyano-1-(4-methoxyphenyl)-5-methylhexan-3-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R,3S)-1-isocyano-1-(4-methoxyphenyl)-5-methylhexan-3-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 100962662 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-[(1R,3S)-1-isocyano-1-(4-methoxyphenyl)-5-methylhexan-3-yl]-4-methylbenzenesulfonamide |
| SMILES | [C-]#[N+][C@H](C[C@H](CC(C)C)NS(=O)(=O)c1ccc(C)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H28N2O3S/c1-16(2)14-19(24-28(25,26)21-12-6-17(3)7-13-21)15-22(23-4)18-8-10-20(27-5)11-9-18/h6-13,16,19,22,24H,14-15H2,1-3,5H3/t19-,22+/m0/s1 |
| InChIKey | BSKRTOSVTMRCQP-SIKLNZKXSA-N |
| XLogP | 4.75 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|