C16H25NO2S — CID 57149498
N-(2,6-dimethylhept-1-en-4-yl)-4-methylbenzenesulfonamide (PubChem CID 57149498) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is N-(2,6-dimethylhept-1-en-4-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(2,6-dimethylhept-1-en-4-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 57149498 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-(2,6-dimethylhept-1-en-4-yl)-4-methylbenzenesulfonamide |
| SMILES | C=C(C)CC(CC(C)C)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H25NO2S/c1-12(2)10-15(11-13(3)4)17-20(18,19)16-8-6-14(5)7-9-16/h6-9,13,15,17H,1,10-11H2,2-5H3 |
| InChIKey | WUGNATDKDZIYCQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|