C18H25NO3S — CID 11566206
4-methyl-N-[(4S)-2-methyl-8-oxodec-6-yn-4-yl]benzenesulfonamide (PubChem CID 11566206) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is 4-methyl-N-[(4S)-2-methyl-8-oxodec-6-yn-4-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(4S)-2-methyl-8-oxodec-6-yn-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 11566206 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 4-methyl-N-[(4S)-2-methyl-8-oxodec-6-yn-4-yl]benzenesulfonamide |
| SMILES | CCC(=O)C#CC[C@H](CC(C)C)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H25NO3S/c1-5-17(20)8-6-7-16(13-14(2)3)19-23(21,22)18-11-9-15(4)10-12-18/h9-12,14,16,19H,5,7,13H2,1-4H3/t16-/m1/s1 |
| InChIKey | ZLULWJIXKGIZNA-MRXNPFEDSA-N |
| XLogP | 3.06 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|