C17H25NO4S — CID 23239877
ethyl (Z)-6-methyl-4-[(4-methylphenyl)sulfonylamino]hept-2-enoate (PubChem CID 23239877) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is ethyl (Z)-6-methyl-4-[(4-methylphenyl)sulfonylamino]hept-2-enoate.
| Compound Name | ethyl (Z)-6-methyl-4-[(4-methylphenyl)sulfonylamino]hept-2-enoate |
|---|---|
| PubChem CID | 23239877 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | ethyl (Z)-6-methyl-4-[(4-methylphenyl)sulfonylamino]hept-2-enoate |
| SMILES | CCOC(=O)/C=C\C(CC(C)C)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H25NO4S/c1-5-22-17(19)11-8-15(12-13(2)3)18-23(20,21)16-9-6-14(4)7-10-16/h6-11,13,15,18H,5,12H2,1-4H3/b11-8- |
| InChIKey | RQCFOTLEUVMGRO-FLIBITNWSA-N |
| XLogP | 2.81 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|