C17H24N4O4S — CID 102342022
ethyl (E,4S,5R)-4-azido-5-[(4-methylphenyl)sulfonylamino]oct-2-enoate (PubChem CID 102342022) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is ethyl (E,4S,5R)-4-azido-5-[(4-methylphenyl)sulfonylamino]oct-2-enoate.
| Compound Name | ethyl (E,4S,5R)-4-azido-5-[(4-methylphenyl)sulfonylamino]oct-2-enoate |
|---|---|
| PubChem CID | 102342022 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | ethyl (E,4S,5R)-4-azido-5-[(4-methylphenyl)sulfonylamino]oct-2-enoate |
| SMILES | CCC[C@@H](NS(=O)(=O)c1ccc(C)cc1)[C@H](/C=C/C(=O)OCC)N=[N+]=[N-] |
| InChI | InChI=1S/C17H24N4O4S/c1-4-6-16(15(19-21-18)11-12-17(22)25-5-2)20-26(23,24)14-9-7-13(3)8-10-14/h7-12,15-16,20H,4-6H2,1-3H3/b12-11+/t15-,16+/m0/s1 |
| InChIKey | YSYSMFGVTCBUGD-HMUVLFPJSA-N |
| XLogP | 3.24 |
| TPSA | 121.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|