C22H27NO6S — CID 23659117
diethyl 2-[(4-methylphenyl)-[(4-methylphenyl)sulfonylamino]methyl]propanedioate (PubChem CID 23659117) has the molecular formula C22H27NO6S and a molecular weight of 433.53 g/mol. Its IUPAC name is diethyl 2-[(4-methylphenyl)-[(4-methylphenyl)sulfonylamino]methyl]propanedioate.
| Compound Name | diethyl 2-[(4-methylphenyl)-[(4-methylphenyl)sulfonylamino]methyl]propanedioate |
|---|---|
| PubChem CID | 23659117 |
| Molecular Formula | C22H27NO6S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | diethyl 2-[(4-methylphenyl)-[(4-methylphenyl)sulfonylamino]methyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(NS(=O)(=O)c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H27NO6S/c1-5-28-21(24)19(22(25)29-6-2)20(17-11-7-15(3)8-12-17)23-30(26,27)18-13-9-16(4)10-14-18/h7-14,19-20,23H,5-6H2,1-4H3 |
| InChIKey | PEMAXUCOYZFSSU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|