C18H21InN2O4S — CID 177388669
CID 177388669 (PubChem CID 177388669) has the molecular formula C18H21InN2O4S and a molecular weight of 476.26 g/mol.
| Compound Name | CID 177388669 |
|---|---|
| PubChem CID | 177388669 |
| Molecular Formula | C18H21InN2O4S |
| Molecular Weight | 476.26 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | — |
| SMILES | CCOC(=O)[C@H](N)[C@H](NS(=O)(=O)c1ccc(C)cc1)c1ccc([In])cc1 |
| InChI | InChI=1S/C18H21N2O4S.In/c1-3-24-18(21)16(19)17(14-7-5-4-6-8-14)20-25(22,23)15-11-9-13(2)10-12-15;/h5-12,16-17,20H,3,19H2,1-2H3;/t16-,17-;/m1./s1 |
| InChIKey | IZWHTOHQLFZRKQ-GBNZRNLASA-N |
| XLogP | 0.70 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |