C19H21NO4S — CID 11279844
ethyl 2-[benzenesulfonamido(phenyl)methyl]but-3-enoate (PubChem CID 11279844) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is ethyl 2-[benzenesulfonamido(phenyl)methyl]but-3-enoate.
| Compound Name | ethyl 2-[benzenesulfonamido(phenyl)methyl]but-3-enoate |
|---|---|
| PubChem CID | 11279844 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | ethyl 2-[benzenesulfonamido(phenyl)methyl]but-3-enoate |
| SMILES | C=CC(C(=O)OCC)C(NS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H21NO4S/c1-3-17(19(21)24-4-2)18(15-11-7-5-8-12-15)20-25(22,23)16-13-9-6-10-14-16/h3,5-14,17-18,20H,1,4H2,2H3 |
| InChIKey | NKRWCROOEBZMQG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|