C17H19NO2S — CID 11781627
N-[(1R,2S)-2-deuterio-2-methyl-1-phenylbut-3-enyl]benzenesulfonamide (PubChem CID 11781627) has the molecular formula C17H19NO2S and a molecular weight of 302.42 g/mol. Its IUPAC name is N-[(1R,2S)-2-deuterio-2-methyl-1-phenylbut-3-enyl]benzenesulfonamide.
| Compound Name | N-[(1R,2S)-2-deuterio-2-methyl-1-phenylbut-3-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11781627 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-[(1R,2S)-2-deuterio-2-methyl-1-phenylbut-3-enyl]benzenesulfonamide |
| SMILES | [2H][C@](C)(C=C)[C@@H](NS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO2S/c1-3-14(2)17(15-10-6-4-7-11-15)18-21(19,20)16-12-8-5-9-13-16/h3-14,17-18H,1H2,2H3/t14-,17+/m0/s1/i14D |
| InChIKey | OPEKKGLLEMTSTC-CJVWTRNZSA-N |
| XLogP | 3.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|