C22H20N2O4S — CID 24895142
N-[(1R,2R)-1-(4-nitrophenyl)-2-phenylbut-3-enyl]benzenesulfonamide (PubChem CID 24895142) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is N-[(1R,2R)-1-(4-nitrophenyl)-2-phenylbut-3-enyl]benzenesulfonamide.
| Compound Name | N-[(1R,2R)-1-(4-nitrophenyl)-2-phenylbut-3-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24895142 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N-[(1R,2R)-1-(4-nitrophenyl)-2-phenylbut-3-enyl]benzenesulfonamide |
| SMILES | C=C[C@H](c1ccccc1)[C@@H](NS(=O)(=O)c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H20N2O4S/c1-2-21(17-9-5-3-6-10-17)22(18-13-15-19(16-14-18)24(25)26)23-29(27,28)20-11-7-4-8-12-20/h2-16,21-23H,1H2/t21-,22+/m1/s1 |
| InChIKey | OXBYNQYEPZDZEC-YADHBBJMSA-N |
| XLogP | 4.58 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|