C18H18N2O4S — CID 102085441
N-[(1S,2Z)-1-(4-methylphenyl)penta-2,4-dienyl]-4-nitrobenzenesulfonamide (PubChem CID 102085441) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is N-[(1S,2Z)-1-(4-methylphenyl)penta-2,4-dienyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[(1S,2Z)-1-(4-methylphenyl)penta-2,4-dienyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 102085441 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | N-[(1S,2Z)-1-(4-methylphenyl)penta-2,4-dienyl]-4-nitrobenzenesulfonamide |
| SMILES | C=C/C=C\[C@H](NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H18N2O4S/c1-3-4-5-18(15-8-6-14(2)7-9-15)19-25(23,24)17-12-10-16(11-13-17)20(21)22/h3-13,18-19H,1H2,2H3/b5-4-/t18-/m0/s1 |
| InChIKey | HKPBUBUSABHBNP-XDXAGZTOSA-N |
| XLogP | 3.67 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|