C20H20N2O6S — CID 101383023
ethenyl (E)-2-[[(4-methylphenyl)sulfonylamino]-(4-nitrophenyl)methyl]but-2-enoate (PubChem CID 101383023) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is ethenyl (E)-2-[[(4-methylphenyl)sulfonylamino]-(4-nitrophenyl)methyl]but-2-enoate.
| Compound Name | ethenyl (E)-2-[[(4-methylphenyl)sulfonylamino]-(4-nitrophenyl)methyl]but-2-enoate |
|---|---|
| PubChem CID | 101383023 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | ethenyl (E)-2-[[(4-methylphenyl)sulfonylamino]-(4-nitrophenyl)methyl]but-2-enoate |
| SMILES | C=COC(=O)/C(=C/C)C(NS(=O)(=O)c1ccc(C)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H20N2O6S/c1-4-18(20(23)28-5-2)19(15-8-10-16(11-9-15)22(24)25)21-29(26,27)17-12-6-14(3)7-13-17/h4-13,19,21H,2H2,1,3H3/b18-4+ |
| InChIKey | AJAVQRRXLVDWCG-JJPRUIFNSA-N |
| XLogP | 3.56 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|