C25H23NO4S — CID 101383030
phenyl (2E)-2-[[(4-methylphenyl)sulfonylamino]-phenylmethyl]penta-2,4-dienoate (PubChem CID 101383030) has the molecular formula C25H23NO4S and a molecular weight of 433.53 g/mol. Its IUPAC name is phenyl (2E)-2-[[(4-methylphenyl)sulfonylamino]-phenylmethyl]penta-2,4-dienoate.
| Compound Name | phenyl (2E)-2-[[(4-methylphenyl)sulfonylamino]-phenylmethyl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 101383030 |
| Molecular Formula | C25H23NO4S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | phenyl (2E)-2-[[(4-methylphenyl)sulfonylamino]-phenylmethyl]penta-2,4-dienoate |
| SMILES | C=C/C=C(/C(=O)Oc1ccccc1)C(NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H23NO4S/c1-3-10-23(25(27)30-21-13-8-5-9-14-21)24(20-11-6-4-7-12-20)26-31(28,29)22-17-15-19(2)16-18-22/h3-18,24,26H,1H2,2H3/b23-10+ |
| InChIKey | XJBUIFCTVKCDLN-AUEPDCJTSA-N |
| XLogP | 4.73 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|