C25H25NO4S — CID 102465480
phenyl 2-[(S)-(4-ethylphenyl)-[(4-methylphenyl)sulfonylamino]methyl]prop-2-enoate (PubChem CID 102465480) has the molecular formula C25H25NO4S and a molecular weight of 435.55 g/mol. Its IUPAC name is phenyl 2-[(S)-(4-ethylphenyl)-[(4-methylphenyl)sulfonylamino]methyl]prop-2-enoate.
| Compound Name | phenyl 2-[(S)-(4-ethylphenyl)-[(4-methylphenyl)sulfonylamino]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 102465480 |
| Molecular Formula | C25H25NO4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | phenyl 2-[(S)-(4-ethylphenyl)-[(4-methylphenyl)sulfonylamino]methyl]prop-2-enoate |
| SMILES | C=C(C(=O)Oc1ccccc1)[C@@H](NS(=O)(=O)c1ccc(C)cc1)c1ccc(CC)cc1 |
| InChI | InChI=1S/C25H25NO4S/c1-4-20-12-14-21(15-13-20)24(19(3)25(27)30-22-8-6-5-7-9-22)26-31(28,29)23-16-10-18(2)11-17-23/h5-17,24,26H,3-4H2,1-2H3/t24-/m1/s1 |
| InChIKey | OAFUJVIQWOFBGB-XMMPIXPASA-N |
| XLogP | 4.74 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|