C28H25NO6S — CID 135055280
naphthalen-2-yl 2-[(S)-(4-methoxyphenyl)-[(4-methoxyphenyl)sulfonylamino]methyl]prop-2-enoate (PubChem CID 135055280) has the molecular formula C28H25NO6S and a molecular weight of 503.58 g/mol. Its IUPAC name is naphthalen-2-yl 2-[(S)-(4-methoxyphenyl)-[(4-methoxyphenyl)sulfonylamino]methyl]prop-2-enoate.
| Compound Name | naphthalen-2-yl 2-[(S)-(4-methoxyphenyl)-[(4-methoxyphenyl)sulfonylamino]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 135055280 |
| Molecular Formula | C28H25NO6S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | naphthalen-2-yl 2-[(S)-(4-methoxyphenyl)-[(4-methoxyphenyl)sulfonylamino]methyl]prop-2-enoate |
| SMILES | C=C(C(=O)Oc1ccc2ccccc2c1)[C@@H](NS(=O)(=O)c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H25NO6S/c1-19(28(30)35-25-13-8-20-6-4-5-7-22(20)18-25)27(21-9-11-23(33-2)12-10-21)29-36(31,32)26-16-14-24(34-3)15-17-26/h4-18,27,29H,1H2,2-3H3/t27-/m1/s1 |
| InChIKey | MGLLIGLGOLHMTC-HHHXNRCGSA-N |
| XLogP | 5.04 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|