C18H14NO4S- — CID 5210543
2-(naphthalen-2-ylsulfonylamino)-2-phenylacetate (PubChem CID 5210543) has the molecular formula C18H14NO4S- and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-(naphthalen-2-ylsulfonylamino)-2-phenylacetate.
| Compound Name | 2-(naphthalen-2-ylsulfonylamino)-2-phenylacetate |
|---|---|
| PubChem CID | 5210543 |
| Molecular Formula | C18H14NO4S- |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 2-(naphthalen-2-ylsulfonylamino)-2-phenylacetate |
| SMILES | O=C([O-])C(NS(=O)(=O)c1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C18H15NO4S/c20-18(21)17(14-7-2-1-3-8-14)19-24(22,23)16-11-10-13-6-4-5-9-15(13)12-16/h1-12,17,19H,(H,20,21)/p-1 |
| InChIKey | UDTRIHNSADWKRA-UHFFFAOYSA-M |
| XLogP | 1.61 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |