C19H16NO5S- — CID 7375485
(2R,3S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)-3-phenylpropanoate (PubChem CID 7375485) has the molecular formula C19H16NO5S- and a molecular weight of 370.41 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)-3-phenylpropanoate.
| Compound Name | (2R,3S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 7375485 |
| Molecular Formula | C19H16NO5S- |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | (2R,3S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)-3-phenylpropanoate |
| SMILES | O=C([O-])[C@H](NS(=O)(=O)c1ccc2ccccc2c1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C19H17NO5S/c21-18(14-7-2-1-3-8-14)17(19(22)23)20-26(24,25)16-11-10-13-6-4-5-9-15(13)12-16/h1-12,17-18,20-21H,(H,22,23)/p-1/t17-,18+/m1/s1 |
| InChIKey | HNRPARUHQYYJCO-MSOLQXFVSA-M |
| XLogP | 0.97 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |