C15H16N2O5S — CID 40547562
(2S,3S)-2-[(3-aminophenyl)sulfonylamino]-3-hydroxy-3-phenylpropanoic acid (PubChem CID 40547562) has the molecular formula C15H16N2O5S and a molecular weight of 336.37 g/mol. Its IUPAC name is (2S,3S)-2-[(3-aminophenyl)sulfonylamino]-3-hydroxy-3-phenylpropanoic acid.
| Compound Name | (2S,3S)-2-[(3-aminophenyl)sulfonylamino]-3-hydroxy-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 40547562 |
| Molecular Formula | C15H16N2O5S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | (2S,3S)-2-[(3-aminophenyl)sulfonylamino]-3-hydroxy-3-phenylpropanoic acid |
| SMILES | Nc1cccc(S(=O)(=O)N[C@H](C(=O)O)[C@@H](O)c2ccccc2)c1 |
| InChI | InChI=1S/C15H16N2O5S/c16-11-7-4-8-12(9-11)23(21,22)17-13(15(19)20)14(18)10-5-2-1-3-6-10/h1-9,13-14,17-18H,16H2,(H,19,20)/t13-,14-/m0/s1 |
| InChIKey | GCFUZDZUUFRMSG-KBPBESRZSA-N |
| XLogP | 0.73 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|