C15H17N3O6S — CID 40549704
3-amino-N-[(1S,2S)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]benzenesulfonamide (PubChem CID 40549704) has the molecular formula C15H17N3O6S and a molecular weight of 367.38 g/mol. Its IUPAC name is 3-amino-N-[(1S,2S)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]benzenesulfonamide.
| Compound Name | 3-amino-N-[(1S,2S)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 40549704 |
| Molecular Formula | C15H17N3O6S |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 3-amino-N-[(1S,2S)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]benzenesulfonamide |
| SMILES | Nc1cccc(S(=O)(=O)N[C@@H](CO)[C@@H](O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C15H17N3O6S/c16-11-2-1-3-13(8-11)25(23,24)17-14(9-19)15(20)10-4-6-12(7-5-10)18(21)22/h1-8,14-15,17,19-20H,9,16H2/t14-,15-/m0/s1 |
| InChIKey | XJFZMYQMBQILKK-GJZGRUSLSA-N |
| XLogP | 0.55 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|