C17H20N2O4 — CID 110880905
2-[(3-methylphenyl)methylamino]-1-(4-nitrophenyl)propane-1,3-diol (PubChem CID 110880905) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-[(3-methylphenyl)methylamino]-1-(4-nitrophenyl)propane-1,3-diol.
| Compound Name | 2-[(3-methylphenyl)methylamino]-1-(4-nitrophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 110880905 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-[(3-methylphenyl)methylamino]-1-(4-nitrophenyl)propane-1,3-diol |
| SMILES | Cc1cccc(CNC(CO)C(O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C17H20N2O4/c1-12-3-2-4-13(9-12)10-18-16(11-20)17(21)14-5-7-15(8-6-14)19(22)23/h2-9,16-18,20-21H,10-11H2,1H3 |
| InChIKey | JRMZQPOYBQFWDE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|