C16H16Cl2N2O4 — CID 31085704
(1S,2R)-2-[(3,4-dichlorophenyl)methylamino]-1-(4-nitrophenyl)propane-1,3-diol (PubChem CID 31085704) has the molecular formula C16H16Cl2N2O4 and a molecular weight of 371.22 g/mol. Its IUPAC name is (1S,2R)-2-[(3,4-dichlorophenyl)methylamino]-1-(4-nitrophenyl)propane-1,3-diol.
| Compound Name | (1S,2R)-2-[(3,4-dichlorophenyl)methylamino]-1-(4-nitrophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 31085704 |
| Molecular Formula | C16H16Cl2N2O4 |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | (1S,2R)-2-[(3,4-dichlorophenyl)methylamino]-1-(4-nitrophenyl)propane-1,3-diol |
| SMILES | O=[N+]([O-])c1ccc([C@H](O)[C@@H](CO)NCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H16Cl2N2O4/c17-13-6-1-10(7-14(13)18)8-19-15(9-21)16(22)11-2-4-12(5-3-11)20(23)24/h1-7,15-16,19,21-22H,8-9H2/t15-,16+/m1/s1 |
| InChIKey | RXHJXHYWDLEDAX-CVEARBPZSA-N |
| XLogP | 3.09 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|