C16H17FN2O4 — CID 110880895
2-[(2-fluorophenyl)methylamino]-1-(4-nitrophenyl)propane-1,3-diol (PubChem CID 110880895) has the molecular formula C16H17FN2O4 and a molecular weight of 320.32 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methylamino]-1-(4-nitrophenyl)propane-1,3-diol.
| Compound Name | 2-[(2-fluorophenyl)methylamino]-1-(4-nitrophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 110880895 |
| Molecular Formula | C16H17FN2O4 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-[(2-fluorophenyl)methylamino]-1-(4-nitrophenyl)propane-1,3-diol |
| SMILES | O=[N+]([O-])c1ccc(C(O)C(CO)NCc2ccccc2F)cc1 |
| InChI | InChI=1S/C16H17FN2O4/c17-14-4-2-1-3-12(14)9-18-15(10-20)16(21)11-5-7-13(8-6-11)19(22)23/h1-8,15-16,18,20-21H,9-10H2 |
| InChIKey | RMTRHGZHVCQQQU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|