C14H24N2O4 — CID 159352873
(1S,2S)-2-(ethylamino)-1-(4-nitrophenyl)propane-1,3-diol;propane (PubChem CID 159352873) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is (1S,2S)-2-(ethylamino)-1-(4-nitrophenyl)propane-1,3-diol;propane.
| Compound Name | (1S,2S)-2-(ethylamino)-1-(4-nitrophenyl)propane-1,3-diol;propane |
|---|---|
| PubChem CID | 159352873 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | (1S,2S)-2-(ethylamino)-1-(4-nitrophenyl)propane-1,3-diol;propane |
| SMILES | CCC.CCN[C@@H](CO)[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H16N2O4.C3H8/c1-2-12-10(7-14)11(15)8-3-5-9(6-4-8)13(16)17;1-3-2/h3-6,10-12,14-15H,2,7H2,1H3;3H2,1-2H3/t10-,11-;/m0./s1 |
| InChIKey | LHNYDUDXDXLETC-ACMTZBLWSA-N |
| XLogP | 2.01 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|