C13H21N3O4 — CID 66658329
(1R,2R)-2-(4-aminobutylamino)-1-(4-nitrophenyl)propane-1,3-diol (PubChem CID 66658329) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is (1R,2R)-2-(4-aminobutylamino)-1-(4-nitrophenyl)propane-1,3-diol.
| Compound Name | (1R,2R)-2-(4-aminobutylamino)-1-(4-nitrophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 66658329 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | (1R,2R)-2-(4-aminobutylamino)-1-(4-nitrophenyl)propane-1,3-diol |
| SMILES | NCCCCN[C@H](CO)[C@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H21N3O4/c14-7-1-2-8-15-12(9-17)13(18)10-3-5-11(6-4-10)16(19)20/h3-6,12-13,15,17-18H,1-2,7-9,14H2/t12-,13-/m1/s1 |
| InChIKey | MWWLNJPKDKOGNV-CHWSQXEVSA-N |
| XLogP | 0.32 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|