C9H10N2O6 — CID 13468905
2-nitro-1-(4-nitrophenyl)propane-1,3-diol (PubChem CID 13468905) has the molecular formula C9H10N2O6 and a molecular weight of 242.19 g/mol. Its IUPAC name is 2-nitro-1-(4-nitrophenyl)propane-1,3-diol.
| Compound Name | 2-nitro-1-(4-nitrophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 13468905 |
| Molecular Formula | C9H10N2O6 |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-nitro-1-(4-nitrophenyl)propane-1,3-diol |
| SMILES | O=[N+]([O-])c1ccc(C(O)C(CO)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H10N2O6/c12-5-8(11(16)17)9(13)6-1-3-7(4-2-6)10(14)15/h1-4,8-9,12-13H,5H2 |
| InChIKey | ORGZEULXRXFJQB-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|