C11H16N2O4 — CID 2063355
(1S,2S)-2-(dimethylamino)-1-(4-nitrophenyl)propane-1,3-diol (PubChem CID 2063355) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is (1S,2S)-2-(dimethylamino)-1-(4-nitrophenyl)propane-1,3-diol.
| Compound Name | (1S,2S)-2-(dimethylamino)-1-(4-nitrophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 2063355 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | (1S,2S)-2-(dimethylamino)-1-(4-nitrophenyl)propane-1,3-diol |
| SMILES | CN(C)[C@@H](CO)[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H16N2O4/c1-12(2)10(7-14)11(15)8-3-5-9(6-4-8)13(16)17/h3-6,10-11,14-15H,7H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | WKFXOUSFZMOKOH-QWRGUYRKSA-N |
| XLogP | 0.55 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|