C13H20N2O4 — CID 71362664
(1S,2S)-2-(diethylamino)-1-(4-nitrophenyl)propane-1,3-diol (PubChem CID 71362664) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is (1S,2S)-2-(diethylamino)-1-(4-nitrophenyl)propane-1,3-diol.
| Compound Name | (1S,2S)-2-(diethylamino)-1-(4-nitrophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 71362664 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | (1S,2S)-2-(diethylamino)-1-(4-nitrophenyl)propane-1,3-diol |
| SMILES | CCN(CC)[C@@H](CO)[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H20N2O4/c1-3-14(4-2)12(9-16)13(17)10-5-7-11(8-6-10)15(18)19/h5-8,12-13,16-17H,3-4,9H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | DKPBTCVTLFACTN-STQMWFEESA-N |
| XLogP | 1.33 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|