C12H19N2O4+ — CID 15564385
[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-trimethylazanium (PubChem CID 15564385) has the molecular formula C12H19N2O4+ and a molecular weight of 255.29 g/mol. Its IUPAC name is [1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-trimethylazanium.
| Compound Name | [1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-trimethylazanium |
|---|---|
| PubChem CID | 15564385 |
| Molecular Formula | C12H19N2O4+ |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | [1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-trimethylazanium |
| SMILES | C[N+](C)(C)C(CO)C(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H19N2O4/c1-14(2,3)11(8-15)12(16)9-4-6-10(7-5-9)13(17)18/h4-7,11-12,15-16H,8H2,1-3H3/q+1 |
| InChIKey | NNNRZPBUPNYNHX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|