C9H13N3O7 — CID 165362766
2-amino-1-(4-nitrophenyl)propane-1,3-diol;nitric acid (PubChem CID 165362766) has the molecular formula C9H13N3O7 and a molecular weight of 275.22 g/mol. Its IUPAC name is 2-amino-1-(4-nitrophenyl)propane-1,3-diol;nitric acid.
| Compound Name | 2-amino-1-(4-nitrophenyl)propane-1,3-diol;nitric acid |
|---|---|
| PubChem CID | 165362766 |
| Molecular Formula | C9H13N3O7 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-amino-1-(4-nitrophenyl)propane-1,3-diol;nitric acid |
| SMILES | NC(CO)C(O)c1ccc([N+](=O)[O-])cc1.O=[N+]([O-])O |
| InChI | InChI=1S/C9H12N2O4.HNO3/c10-8(5-12)9(13)6-1-3-7(4-2-6)11(14)15;2-1(3)4/h1-4,8-9,12-13H,5,10H2;(H,2,3,4) |
| InChIKey | PGDGXLGUKRSWSX-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 172.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|