2-amino-1-(4-nitrophenyl)propane-1,3-diol;nitric acid

C9H13N3O7 — CID 165362766

IUPAC2-amino-1-(4-nitrophenyl)propane-1,3-diol;nitric acid
SMILESNC(CO)C(O)c1ccc([N+](=O)[O-])cc1.O=[N+]([O-])O
InChIInChI=1S/C9H12N2O4.HNO3/c10-8(5-12)9(13)6-1-3-7(4-2-6)11(14)15;2-1(3)4/h1-4,8-9,12-13H,5,10H2;(H,2,3,4)
InChIKeyPGDGXLGUKRSWSX-UHFFFAOYSA-N
MW275.22 g/mol
LogP-0.40
Rot. Bonds4

About 2-amino-1-(4-nitrophenyl)propane-1,3-diol;nitric acid

2-amino-1-(4-nitrophenyl)propane-1,3-diol;nitric acid (PubChem CID 165362766) has the molecular formula C9H13N3O7 and a molecular weight of 275.22 g/mol. Its IUPAC name is 2-amino-1-(4-nitrophenyl)propane-1,3-diol;nitric acid.

Molecular Properties

Compound Name2-amino-1-(4-nitrophenyl)propane-1,3-diol;nitric acid
PubChem CID165362766
Molecular FormulaC9H13N3O7
Molecular Weight275.22 g/mol
Exact Mass275.08
IUPAC Name2-amino-1-(4-nitrophenyl)propane-1,3-diol;nitric acid
SMILESNC(CO)C(O)c1ccc([N+](=O)[O-])cc1.O=[N+]([O-])O
InChIInChI=1S/C9H12N2O4.HNO3/c10-8(5-12)9(13)6-1-3-7(4-2-6)11(14)15;2-1(3)4/h1-4,8-9,12-13H,5,10H2;(H,2,3,4)
InChIKeyPGDGXLGUKRSWSX-UHFFFAOYSA-N
XLogP-0.40
TPSA172.99 Ų
H-Bond Donors4
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.22
LogP ≤ 5-0.40
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-amino-1-(4-nitrophenyl)propane-1,3-diol;nitric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-1-(4-nitrophenyl)propane-1,3-diol;nitric acid?
The IUPAC name of 2-amino-1-(4-nitrophenyl)propane-1,3-diol;nitric acid (CID 165362766) is 2-amino-1-(4-nitrophenyl)propane-1,3-diol;nitric acid.
What is the SMILES notation for 2-amino-1-(4-nitrophenyl)propane-1,3-diol;nitric acid?
The canonical SMILES for 2-amino-1-(4-nitrophenyl)propane-1,3-diol;nitric acid is NC(CO)C(O)c1ccc([N+](=O)[O-])cc1.O=[N+]([O-])O.
What is the InChIKey of 2-amino-1-(4-nitrophenyl)propane-1,3-diol;nitric acid?
The InChIKey is PGDGXLGUKRSWSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4.HNO3/c10-8(5-12)9(13)6-1-3-7(4-2-6)11(14)15;2-1(3)4/h1-4,8-9,12-13H,5,10H2;(H,2,3,4).
What are the key properties of 2-amino-1-(4-nitrophenyl)propane-1,3-diol;nitric acid?
2-amino-1-(4-nitrophenyl)propane-1,3-diol;nitric acid has a molecular weight of 275.22 g/mol, XLogP of -0.40, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(4-nitrophenyl)propane-1,3-diol;nitric acid is sourced from PubChem (CID 165362766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).