C18H20N2O9 — CID 151398704
3-[2,3-dihydroxy-1-(4-nitrophenyl)propoxy]-3-(4-nitrophenyl)propane-1,2-diol (PubChem CID 151398704) has the molecular formula C18H20N2O9 and a molecular weight of 408.36 g/mol. Its IUPAC name is 3-[2,3-dihydroxy-1-(4-nitrophenyl)propoxy]-3-(4-nitrophenyl)propane-1,2-diol.
| Compound Name | 3-[2,3-dihydroxy-1-(4-nitrophenyl)propoxy]-3-(4-nitrophenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 151398704 |
| Molecular Formula | C18H20N2O9 |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 3-[2,3-dihydroxy-1-(4-nitrophenyl)propoxy]-3-(4-nitrophenyl)propane-1,2-diol |
| SMILES | O=[N+]([O-])c1ccc(C(OC(c2ccc([N+](=O)[O-])cc2)C(O)CO)C(O)CO)cc1 |
| InChI | InChI=1S/C18H20N2O9/c21-9-15(23)17(11-1-5-13(6-2-11)19(25)26)29-18(16(24)10-22)12-3-7-14(8-4-12)20(27)28/h1-8,15-18,21-24H,9-10H2 |
| InChIKey | OWADBEARODPFNF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 176.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|