C15H15NO5 — CID 102380116
(2S,3R)-3-(4-nitrophenoxy)-3-phenylpropane-1,2-diol (PubChem CID 102380116) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is (2S,3R)-3-(4-nitrophenoxy)-3-phenylpropane-1,2-diol.
| Compound Name | (2S,3R)-3-(4-nitrophenoxy)-3-phenylpropane-1,2-diol |
|---|---|
| PubChem CID | 102380116 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | (2S,3R)-3-(4-nitrophenoxy)-3-phenylpropane-1,2-diol |
| SMILES | O=[N+]([O-])c1ccc(O[C@H](c2ccccc2)[C@@H](O)CO)cc1 |
| InChI | InChI=1S/C15H15NO5/c17-10-14(18)15(11-4-2-1-3-5-11)21-13-8-6-12(7-9-13)16(19)20/h1-9,14-15,17-18H,10H2/t14-,15+/m0/s1 |
| InChIKey | KQGAYZNUNVICII-LSDHHAIUSA-N |
| XLogP | 2.07 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|