C19H23N3O5 — CID 6611997
1-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-3-(2,4,6-trimethylphenyl)urea (PubChem CID 6611997) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is 1-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-3-(2,4,6-trimethylphenyl)urea.
| Compound Name | 1-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-3-(2,4,6-trimethylphenyl)urea |
|---|---|
| PubChem CID | 6611997 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 1-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-3-(2,4,6-trimethylphenyl)urea |
| SMILES | Cc1cc(C)c(NC(=O)NC(CO)C(O)c2ccc([N+](=O)[O-])cc2)c(C)c1 |
| InChI | InChI=1S/C19H23N3O5/c1-11-8-12(2)17(13(3)9-11)21-19(25)20-16(10-23)18(24)14-4-6-15(7-5-14)22(26)27/h4-9,16,18,23-24H,10H2,1-3H3,(H2,20,21,25) |
| InChIKey | APCJYBGLFWUFSE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 124.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|