C17H21NO2 — CID 160710690
(1R,2R)-2-(benzylamino)-1-(4-methylphenyl)propane-1,3-diol (PubChem CID 160710690) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (1R,2R)-2-(benzylamino)-1-(4-methylphenyl)propane-1,3-diol.
| Compound Name | (1R,2R)-2-(benzylamino)-1-(4-methylphenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 160710690 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (1R,2R)-2-(benzylamino)-1-(4-methylphenyl)propane-1,3-diol |
| SMILES | Cc1ccc([C@@H](O)[C@@H](CO)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H21NO2/c1-13-7-9-15(10-8-13)17(20)16(12-19)18-11-14-5-3-2-4-6-14/h2-10,16-20H,11-12H2,1H3/t16-,17-/m1/s1 |
| InChIKey | QDEZXYUNWCWWIQ-IAGOWNOFSA-N |
| XLogP | 2.18 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |