C17H21NO2S — CID 11301148
(1S,2S)-2-(benzylamino)-1-(4-methylsulfanylphenyl)propane-1,3-diol (PubChem CID 11301148) has the molecular formula C17H21NO2S and a molecular weight of 303.43 g/mol. Its IUPAC name is (1S,2S)-2-(benzylamino)-1-(4-methylsulfanylphenyl)propane-1,3-diol.
| Compound Name | (1S,2S)-2-(benzylamino)-1-(4-methylsulfanylphenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 11301148 |
| Molecular Formula | C17H21NO2S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | (1S,2S)-2-(benzylamino)-1-(4-methylsulfanylphenyl)propane-1,3-diol |
| SMILES | CSc1ccc([C@H](O)[C@H](CO)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H21NO2S/c1-21-15-9-7-14(8-10-15)17(20)16(12-19)18-11-13-5-3-2-4-6-13/h2-10,16-20H,11-12H2,1H3/t16-,17-/m0/s1 |
| InChIKey | XVQMBLAYQPMXLB-IRXDYDNUSA-N |
| XLogP | 2.59 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |