C16H20N2S — CID 60709682
N-benzyl-1-(4-methylsulfanylphenyl)ethane-1,2-diamine (PubChem CID 60709682) has the molecular formula C16H20N2S and a molecular weight of 272.42 g/mol. Its IUPAC name is N-benzyl-1-(4-methylsulfanylphenyl)ethane-1,2-diamine.
| Compound Name | N-benzyl-1-(4-methylsulfanylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 60709682 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-benzyl-1-(4-methylsulfanylphenyl)ethane-1,2-diamine |
| SMILES | CSc1ccc(C(CN)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H20N2S/c1-19-15-9-7-14(8-10-15)16(11-17)18-12-13-5-3-2-4-6-13/h2-10,16,18H,11-12,17H2,1H3 |
| InChIKey | RYNZOGVBDIHFFQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |