C14H20N2S — CID 116643336
1-(4-methylsulfanylphenyl)-N-pent-3-ynylethane-1,2-diamine (PubChem CID 116643336) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is 1-(4-methylsulfanylphenyl)-N-pent-3-ynylethane-1,2-diamine.
| Compound Name | 1-(4-methylsulfanylphenyl)-N-pent-3-ynylethane-1,2-diamine |
|---|---|
| PubChem CID | 116643336 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-(4-methylsulfanylphenyl)-N-pent-3-ynylethane-1,2-diamine |
| SMILES | CC#CCCNC(CN)c1ccc(SC)cc1 |
| InChI | InChI=1S/C14H20N2S/c1-3-4-5-10-16-14(11-15)12-6-8-13(17-2)9-7-12/h6-9,14,16H,5,10-11,15H2,1-2H3 |
| InChIKey | RILYDFUOLPRYAS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|