C11H16N2O — CID 116643387
1-(furan-3-yl)-N-pent-3-ynylethane-1,2-diamine (PubChem CID 116643387) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-(furan-3-yl)-N-pent-3-ynylethane-1,2-diamine.
| Compound Name | 1-(furan-3-yl)-N-pent-3-ynylethane-1,2-diamine |
|---|---|
| PubChem CID | 116643387 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-(furan-3-yl)-N-pent-3-ynylethane-1,2-diamine |
| SMILES | CC#CCCNC(CN)c1ccoc1 |
| InChI | InChI=1S/C11H16N2O/c1-2-3-4-6-13-11(8-12)10-5-7-14-9-10/h5,7,9,11,13H,4,6,8,12H2,1H3 |
| InChIKey | UEAVQNQLPPVKKI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|