C14H17F3N2 — CID 116643484
N-pent-3-ynyl-1-[4-(trifluoromethyl)phenyl]ethane-1,2-diamine (PubChem CID 116643484) has the molecular formula C14H17F3N2 and a molecular weight of 270.30 g/mol. Its IUPAC name is N-pent-3-ynyl-1-[4-(trifluoromethyl)phenyl]ethane-1,2-diamine.
| Compound Name | N-pent-3-ynyl-1-[4-(trifluoromethyl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 116643484 |
| Molecular Formula | C14H17F3N2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | N-pent-3-ynyl-1-[4-(trifluoromethyl)phenyl]ethane-1,2-diamine |
| SMILES | CC#CCCNC(CN)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3N2/c1-2-3-4-9-19-13(10-18)11-5-7-12(8-6-11)14(15,16)17/h5-8,13,19H,4,9-10,18H2,1H3 |
| InChIKey | KWXBPBWFGPVVRP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|