C13H17ClN2 — CID 116643330
1-(3-chlorophenyl)-N-pent-3-ynylethane-1,2-diamine (PubChem CID 116643330) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-pent-3-ynylethane-1,2-diamine.
| Compound Name | 1-(3-chlorophenyl)-N-pent-3-ynylethane-1,2-diamine |
|---|---|
| PubChem CID | 116643330 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 1-(3-chlorophenyl)-N-pent-3-ynylethane-1,2-diamine |
| SMILES | CC#CCCNC(CN)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H17ClN2/c1-2-3-4-8-16-13(10-15)11-6-5-7-12(14)9-11/h5-7,9,13,16H,4,8,10,15H2,1H3 |
| InChIKey | AXFXCAHIMIZLON-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|