C11H17ClN2O — CID 65377403
3-[[2-amino-1-(3-chlorophenyl)ethyl]amino]propan-1-ol (PubChem CID 65377403) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is 3-[[2-amino-1-(3-chlorophenyl)ethyl]amino]propan-1-ol.
| Compound Name | 3-[[2-amino-1-(3-chlorophenyl)ethyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 65377403 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3-[[2-amino-1-(3-chlorophenyl)ethyl]amino]propan-1-ol |
| SMILES | NCC(NCCCO)c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H17ClN2O/c12-10-4-1-3-9(7-10)11(8-13)14-5-2-6-15/h1,3-4,7,11,14-15H,2,5-6,8,13H2 |
| InChIKey | NQZTYPSTHYUKRX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|