C11H16F2N2O — CID 115526912
2-[[2-amino-1-[3-(difluoromethyl)phenyl]ethyl]amino]ethanol (PubChem CID 115526912) has the molecular formula C11H16F2N2O and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-[[2-amino-1-[3-(difluoromethyl)phenyl]ethyl]amino]ethanol.
| Compound Name | 2-[[2-amino-1-[3-(difluoromethyl)phenyl]ethyl]amino]ethanol |
|---|---|
| PubChem CID | 115526912 |
| Molecular Formula | C11H16F2N2O |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2-[[2-amino-1-[3-(difluoromethyl)phenyl]ethyl]amino]ethanol |
| SMILES | NCC(NCCO)c1cccc(C(F)F)c1 |
| InChI | InChI=1S/C11H16F2N2O/c12-11(13)9-3-1-2-8(6-9)10(7-14)15-4-5-16/h1-3,6,10-11,15-16H,4-5,7,14H2 |
| InChIKey | RVQVDAVIBYIOAP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |