C15H22N2O2 — CID 116643369
1-(2,5-dimethoxyphenyl)-N-pent-3-ynylethane-1,2-diamine (PubChem CID 116643369) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-N-pent-3-ynylethane-1,2-diamine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-N-pent-3-ynylethane-1,2-diamine |
|---|---|
| PubChem CID | 116643369 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-N-pent-3-ynylethane-1,2-diamine |
| SMILES | CC#CCCNC(CN)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C15H22N2O2/c1-4-5-6-9-17-14(11-16)13-10-12(18-2)7-8-15(13)19-3/h7-8,10,14,17H,6,9,11,16H2,1-3H3 |
| InChIKey | FRUWCNFDQZLERF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|