C14H21BrN2O — CID 113465486
1-(5-bromo-2-methoxyphenyl)-N-[(E)-pent-3-enyl]ethane-1,2-diamine (PubChem CID 113465486) has the molecular formula C14H21BrN2O and a molecular weight of 313.24 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)-N-[(E)-pent-3-enyl]ethane-1,2-diamine.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)-N-[(E)-pent-3-enyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 113465486 |
| Molecular Formula | C14H21BrN2O |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)-N-[(E)-pent-3-enyl]ethane-1,2-diamine |
| SMILES | C/C=C/CCNC(CN)c1cc(Br)ccc1OC |
| InChI | InChI=1S/C14H21BrN2O/c1-3-4-5-8-17-13(10-16)12-9-11(15)6-7-14(12)18-2/h3-4,6-7,9,13,17H,5,8,10,16H2,1-2H3/b4-3+ |
| InChIKey | MIFOZBRAGZUBEO-ONEGZZNKSA-N |
| XLogP | 3.01 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|