C11H16BrNO3 — CID 66490760
2-(5-bromo-2-methoxyphenyl)-2-(2-hydroxyethylamino)ethanol (PubChem CID 66490760) has the molecular formula C11H16BrNO3 and a molecular weight of 290.16 g/mol. Its IUPAC name is 2-(5-bromo-2-methoxyphenyl)-2-(2-hydroxyethylamino)ethanol.
| Compound Name | 2-(5-bromo-2-methoxyphenyl)-2-(2-hydroxyethylamino)ethanol |
|---|---|
| PubChem CID | 66490760 |
| Molecular Formula | C11H16BrNO3 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 2-(5-bromo-2-methoxyphenyl)-2-(2-hydroxyethylamino)ethanol |
| SMILES | COc1ccc(Br)cc1C(CO)NCCO |
| InChI | InChI=1S/C11H16BrNO3/c1-16-11-3-2-8(12)6-9(11)10(7-15)13-4-5-14/h2-3,6,10,13-15H,4-5,7H2,1H3 |
| InChIKey | QPSUZWQOAJOSRS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |