C14H21BrN2O3 — CID 86779098
1-[1-(5-bromo-2-methoxyphenyl)-2-hydroxyethyl]-3-tert-butylurea (PubChem CID 86779098) has the molecular formula C14H21BrN2O3 and a molecular weight of 345.24 g/mol. Its IUPAC name is 1-[1-(5-bromo-2-methoxyphenyl)-2-hydroxyethyl]-3-tert-butylurea.
| Compound Name | 1-[1-(5-bromo-2-methoxyphenyl)-2-hydroxyethyl]-3-tert-butylurea |
|---|---|
| PubChem CID | 86779098 |
| Molecular Formula | C14H21BrN2O3 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 1-[1-(5-bromo-2-methoxyphenyl)-2-hydroxyethyl]-3-tert-butylurea |
| SMILES | COc1ccc(Br)cc1C(CO)NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H21BrN2O3/c1-14(2,3)17-13(19)16-11(8-18)10-7-9(15)5-6-12(10)20-4/h5-7,11,18H,8H2,1-4H3,(H2,16,17,19) |
| InChIKey | VRVYVKVZGVAURA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |