C15H19BrN2O3 — CID 175406249
[(1S)-2-(4-bromo-2-methoxyphenyl)-1-cyanoethyl] N-tert-butylcarbamate (PubChem CID 175406249) has the molecular formula C15H19BrN2O3 and a molecular weight of 355.23 g/mol. Its IUPAC name is [(1S)-2-(4-bromo-2-methoxyphenyl)-1-cyanoethyl] N-tert-butylcarbamate.
| Compound Name | [(1S)-2-(4-bromo-2-methoxyphenyl)-1-cyanoethyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175406249 |
| Molecular Formula | C15H19BrN2O3 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | [(1S)-2-(4-bromo-2-methoxyphenyl)-1-cyanoethyl] N-tert-butylcarbamate |
| SMILES | COc1cc(Br)ccc1C[C@@H](C#N)OC(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H19BrN2O3/c1-15(2,3)18-14(19)21-12(9-17)7-10-5-6-11(16)8-13(10)20-4/h5-6,8,12H,7H2,1-4H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | WTGCKUZVSZVBCK-LBPRGKRZSA-N |
| XLogP | 3.42 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |